C32H53N3O4Si — CID 144769485
tert-butyl (1R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(1-hydroxyethyl)-7-prop-1-en-2-ylspiro[3,4a,9,9a-tetrahydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1'-carboxylate (PubChem CID 144769485) has the molecular formula C32H53N3O4Si and a molecular weight of 571.88 g/mol. Its IUPAC name is tert-butyl (1R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(1-hydroxyethyl)-7-prop-1-en-2-ylspiro[3,4a,9,9a-tetrahydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (1R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(1-hydroxyethyl)-7-prop-1-en-2-ylspiro[3,4a,9,9a-tetrahydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 144769485 |
| Molecular Formula | C32H53N3O4Si |
| Molecular Weight | 571.88 g/mol |
| Exact Mass | 571.38 |
| IUPAC Name | tert-butyl (1R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(1-hydroxyethyl)-7-prop-1-en-2-ylspiro[3,4a,9,9a-tetrahydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1'-carboxylate |
| SMILES | C=C(C)c1ccc2c(c1)NC1C2C2(CCN(C(=O)OC(C)(C)C)CC2)CN(C(C)O)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H53N3O4Si/c1-21(2)23-12-13-24-25(18-23)33-28-26(19-38-40(10,11)31(7,8)9)35(22(3)36)20-32(27(24)28)14-16-34(17-15-32)29(37)39-30(4,5)6/h12-13,18,22,26-28,33,36H,1,14-17,19-20H2,2-11H3/t22?,26-,27?,28?/m0/s1 |
| InChIKey | MDRHWAFXDMUKOT-IQKKUYFPSA-N |
| XLogP | 6.66 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.88 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|