C14H16F3NO2 — CID 144770290
[1-[(2E,3E)-2-ethylidene-4-(trifluoromethoxy)hexa-3,5-dienyl]pyrrol-3-yl]methanol (PubChem CID 144770290) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is [1-[(2E,3E)-2-ethylidene-4-(trifluoromethoxy)hexa-3,5-dienyl]pyrrol-3-yl]methanol.
| Compound Name | [1-[(2E,3E)-2-ethylidene-4-(trifluoromethoxy)hexa-3,5-dienyl]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 144770290 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [1-[(2E,3E)-2-ethylidene-4-(trifluoromethoxy)hexa-3,5-dienyl]pyrrol-3-yl]methanol |
| SMILES | C=C/C(=C\C(=C/C)Cn1ccc(CO)c1)OC(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c1-3-11(7-13(4-2)20-14(15,16)17)8-18-6-5-12(9-18)10-19/h3-7,9,19H,2,8,10H2,1H3/b11-3+,13-7+ |
| InChIKey | PELWQYSABHOPIJ-QGTBJFKBSA-N |
| XLogP | 3.53 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|