C8H9NO2 — CID 144770801
(2E,4E)-4-[(methylideneamino)methylidene]hexa-2,5-dienoic acid (PubChem CID 144770801) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is (2E,4E)-4-[(methylideneamino)methylidene]hexa-2,5-dienoic acid.
| Compound Name | (2E,4E)-4-[(methylideneamino)methylidene]hexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 144770801 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (2E,4E)-4-[(methylideneamino)methylidene]hexa-2,5-dienoic acid |
| SMILES | C=CC(/C=C/C(=O)O)=C\N=C |
| InChI | InChI=1S/C8H9NO2/c1-3-7(6-9-2)4-5-8(10)11/h3-6H,1-2H2,(H,10,11)/b5-4+,7-6+ |
| InChIKey | AXSSUNCTMPXOIS-YTXTXJHMSA-N |
| XLogP | 1.40 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|