C24H25F5N2 — CID 144775843
(2E)-3-[3-(1,1-difluoroethyl)-5-(4-methylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile;1,1,1-trifluoroethane (PubChem CID 144775843) has the molecular formula C24H25F5N2 and a molecular weight of 436.47 g/mol. Its IUPAC name is (2E)-3-[3-(1,1-difluoroethyl)-5-(4-methylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile;1,1,1-trifluoroethane.
| Compound Name | (2E)-3-[3-(1,1-difluoroethyl)-5-(4-methylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 144775843 |
| Molecular Formula | C24H25F5N2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2E)-3-[3-(1,1-difluoroethyl)-5-(4-methylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile;1,1,1-trifluoroethane |
| SMILES | C=C(C)/C(=C(/C#N)NC)c1cc(-c2ccc(C)cc2)cc(C(C)(F)F)c1.CC(F)(F)F |
| InChI | InChI=1S/C22H22F2N2.C2H3F3/c1-14(2)21(20(13-25)26-5)18-10-17(11-19(12-18)22(4,23)24)16-8-6-15(3)7-9-16;1-2(3,4)5/h6-12,26H,1H2,2-5H3;1H3/b21-20+; |
| InChIKey | JOCOBCFALDZECM-ANVLNOONSA-N |
| XLogP | 7.37 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|