C25H26N2 — CID 144777143
acetylene;(E)-2-(methylamino)-3-[3-[(1E,3E)-3-methyl-4-(2-methylphenyl)buta-1,3-dienyl]phenyl]but-2-enenitrile (PubChem CID 144777143) has the molecular formula C25H26N2 and a molecular weight of 354.50 g/mol. Its IUPAC name is acetylene;(E)-2-(methylamino)-3-[3-[(1E,3E)-3-methyl-4-(2-methylphenyl)buta-1,3-dienyl]phenyl]but-2-enenitrile.
| Compound Name | acetylene;(E)-2-(methylamino)-3-[3-[(1E,3E)-3-methyl-4-(2-methylphenyl)buta-1,3-dienyl]phenyl]but-2-enenitrile |
|---|---|
| PubChem CID | 144777143 |
| Molecular Formula | C25H26N2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | acetylene;(E)-2-(methylamino)-3-[3-[(1E,3E)-3-methyl-4-(2-methylphenyl)buta-1,3-dienyl]phenyl]but-2-enenitrile |
| SMILES | C#C.CN/C(C#N)=C(\C)c1cccc(/C=C/C(C)=C/c2ccccc2C)c1 |
| InChI | InChI=1S/C23H24N2.C2H2/c1-17(14-21-10-6-5-8-18(21)2)12-13-20-9-7-11-22(15-20)19(3)23(16-24)25-4;1-2/h5-15,25H,1-4H3;1-2H/b13-12+,17-14+,23-19+; |
| InChIKey | PCFSDFBBHVJEFZ-KHUKWZKZSA-N |
| XLogP | 5.84 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|