C22H21FN2 — CID 144776492
acetylene;(E)-3-[3-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]-2-(methylamino)pent-2-enenitrile (PubChem CID 144776492) has the molecular formula C22H21FN2 and a molecular weight of 332.42 g/mol. Its IUPAC name is acetylene;(E)-3-[3-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]-2-(methylamino)pent-2-enenitrile.
| Compound Name | acetylene;(E)-3-[3-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]-2-(methylamino)pent-2-enenitrile |
|---|---|
| PubChem CID | 144776492 |
| Molecular Formula | C22H21FN2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | acetylene;(E)-3-[3-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]-2-(methylamino)pent-2-enenitrile |
| SMILES | C#C.CC/C(=C(/C#N)NC)c1cccc(/C=C/c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H19FN2.C2H2/c1-3-19(20(14-22)23-2)17-6-4-5-16(13-17)8-7-15-9-11-18(21)12-10-15;1-2/h4-13,23H,3H2,1-2H3;1-2H/b8-7+,20-19+; |
| InChIKey | CCUSDDGNBQCNKG-VSIXTVHYSA-N |
| XLogP | 5.11 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|