C10H16N2O2 — CID 144778365
[(4E,6Z)-2-aminonona-4,6,8-trienyl] carbamate (PubChem CID 144778365) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is [(4E,6Z)-2-aminonona-4,6,8-trienyl] carbamate.
| Compound Name | [(4E,6Z)-2-aminonona-4,6,8-trienyl] carbamate |
|---|---|
| PubChem CID | 144778365 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | [(4E,6Z)-2-aminonona-4,6,8-trienyl] carbamate |
| SMILES | C=C/C=C\C=C\CC(N)COC(N)=O |
| InChI | InChI=1S/C10H16N2O2/c1-2-3-4-5-6-7-9(11)8-14-10(12)13/h2-6,9H,1,7-8,11H2,(H2,12,13)/b4-3-,6-5+ |
| InChIKey | LKNHYKMEWDNNBQ-DNVGVPOPSA-N |
| XLogP | 1.10 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|