C12H19N3O3 — CID 170075606
[(2R,4E,6Z)-2-amino-4-methylnona-4,6,8-trienyl] N-carbamoylcarbamate (PubChem CID 170075606) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is [(2R,4E,6Z)-2-amino-4-methylnona-4,6,8-trienyl] N-carbamoylcarbamate.
| Compound Name | [(2R,4E,6Z)-2-amino-4-methylnona-4,6,8-trienyl] N-carbamoylcarbamate |
|---|---|
| PubChem CID | 170075606 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | [(2R,4E,6Z)-2-amino-4-methylnona-4,6,8-trienyl] N-carbamoylcarbamate |
| SMILES | C=C/C=C\C=C(/C)C[C@@H](N)COC(=O)NC(N)=O |
| InChI | InChI=1S/C12H19N3O3/c1-3-4-5-6-9(2)7-10(13)8-18-12(17)15-11(14)16/h3-6,10H,1,7-8,13H2,2H3,(H3,14,15,16,17)/b5-4-,9-6+/t10-/m1/s1 |
| InChIKey | BGBWSDKBIYHTEQ-ZGSGDWFZSA-N |
| XLogP | 1.20 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|