C30H35N2O5S- — CID 144780185
3-[4-[3-[4-(dibutylamino)phenyl]-2-oxido-4-oxocyclobut-2-en-1-yl]quinolin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 144780185) has the molecular formula C30H35N2O5S- and a molecular weight of 535.69 g/mol. Its IUPAC name is 3-[4-[3-[4-(dibutylamino)phenyl]-2-oxido-4-oxocyclobut-2-en-1-yl]quinolin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[4-[3-[4-(dibutylamino)phenyl]-2-oxido-4-oxocyclobut-2-en-1-yl]quinolin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 144780185 |
| Molecular Formula | C30H35N2O5S- |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 3-[4-[3-[4-(dibutylamino)phenyl]-2-oxido-4-oxocyclobut-2-en-1-yl]quinolin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCCCN(CCCC)c1ccc(C2=C([O-])C(c3cc[n+](CCCS(=O)(=O)[O-])c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C30H36N2O5S/c1-3-5-17-31(18-6-4-2)23-14-12-22(13-15-23)27-29(33)28(30(27)34)25-16-20-32(19-9-21-38(35,36)37)26-11-8-7-10-24(25)26/h7-8,10-16,20,28H,3-6,9,17-19,21H2,1-2H3,(H-,33,34,35,36,37)/p-1 |
| InChIKey | XWKDJVVURIUNIJ-UHFFFAOYSA-M |
| XLogP | 3.91 |
| TPSA | 104.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|