C53H43NOS — CID 144782049
[6-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-phenylspiro[acridine-9,9'-fluorene]-10-yl]dibenzofuran-4-yl]-trimethyl-λ4-sulfane (PubChem CID 144782049) has the molecular formula C53H43NOS and a molecular weight of 742.00 g/mol. Its IUPAC name is [6-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-phenylspiro[acridine-9,9'-fluorene]-10-yl]dibenzofuran-4-yl]-trimethyl-λ4-sulfane.
| Compound Name | [6-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-phenylspiro[acridine-9,9'-fluorene]-10-yl]dibenzofuran-4-yl]-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 144782049 |
| Molecular Formula | C53H43NOS |
| Molecular Weight | 742.00 g/mol |
| Exact Mass | 741.31 |
| IUPAC Name | [6-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-phenylspiro[acridine-9,9'-fluorene]-10-yl]dibenzofuran-4-yl]-trimethyl-λ4-sulfane |
| SMILES | C=C/C=C(\C=C/C)c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1cc(-c3ccccc3)ccc1N2c1cccc2c1oc1c(S(C)(C)C)cccc12 |
| InChI | InChI=1S/C53H43NOS/c1-6-17-35(18-7-2)37-29-31-47-45(33-37)53(43-25-13-11-21-39(43)40-22-12-14-26-44(40)53)46-34-38(36-19-9-8-10-20-36)30-32-48(46)54(47)49-27-15-23-41-42-24-16-28-50(56(3,4)5)52(42)55-51(41)49/h6-34H,1H2,2-5H3/b18-7-,35-17+ |
| InChIKey | VMKZAHXIWCUVIU-QQZFVEEISA-N |
| XLogP | 14.60 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.00 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|