C26H35N — CID 144782134
2-methylbutane;1-(4-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)isoquinoline (PubChem CID 144782134) has the molecular formula C26H35N and a molecular weight of 361.57 g/mol. Its IUPAC name is 2-methylbutane;1-(4-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)isoquinoline.
| Compound Name | 2-methylbutane;1-(4-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)isoquinoline |
|---|---|
| PubChem CID | 144782134 |
| Molecular Formula | C26H35N |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 2-methylbutane;1-(4-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)isoquinoline |
| SMILES | CCC(C)C.CCC=CCC1CC(C)=CC=C1c1nccc2ccccc12 |
| InChI | InChI=1S/C21H23N.C5H12/c1-3-4-5-9-18-15-16(2)11-12-20(18)21-19-10-7-6-8-17(19)13-14-22-21;1-4-5(2)3/h4-8,10-14,18H,3,9,15H2,1-2H3;5H,4H2,1-3H3 |
| InChIKey | QBOCDGSZVPGBLH-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|