C24H29N — CID 142373858
1-[6-(2,3-dimethylhex-4-en-3-yl)-3-methylcyclohexa-1,3-dien-1-yl]isoquinoline (PubChem CID 142373858) has the molecular formula C24H29N and a molecular weight of 331.50 g/mol. Its IUPAC name is 1-[6-(2,3-dimethylhex-4-en-3-yl)-3-methylcyclohexa-1,3-dien-1-yl]isoquinoline.
| Compound Name | 1-[6-(2,3-dimethylhex-4-en-3-yl)-3-methylcyclohexa-1,3-dien-1-yl]isoquinoline |
|---|---|
| PubChem CID | 142373858 |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[6-(2,3-dimethylhex-4-en-3-yl)-3-methylcyclohexa-1,3-dien-1-yl]isoquinoline |
| SMILES | CC=CC(C)(C(C)C)C1CC=C(C)C=C1c1nccc2ccccc12 |
| InChI | InChI=1S/C24H29N/c1-6-14-24(5,17(2)3)22-12-11-18(4)16-21(22)23-20-10-8-7-9-19(20)13-15-25-23/h6-11,13-17,22H,12H2,1-5H3 |
| InChIKey | HLVNFSSGIWGRAF-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|