C20H21N — CID 145082671
1-(6-but-2-enyl-4-methylcyclohexa-1,3-dien-1-yl)isoquinoline (PubChem CID 145082671) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-(6-but-2-enyl-4-methylcyclohexa-1,3-dien-1-yl)isoquinoline.
| Compound Name | 1-(6-but-2-enyl-4-methylcyclohexa-1,3-dien-1-yl)isoquinoline |
|---|---|
| PubChem CID | 145082671 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(6-but-2-enyl-4-methylcyclohexa-1,3-dien-1-yl)isoquinoline |
| SMILES | CC=CCC1CC(C)=CC=C1c1nccc2ccccc12 |
| InChI | InChI=1S/C20H21N/c1-3-4-7-17-14-15(2)10-11-19(17)20-18-9-6-5-8-16(18)12-13-21-20/h3-6,8-13,17H,7,14H2,1-2H3 |
| InChIKey | JWAZBVUHIMDMAQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|