C25H31N — CID 144787298
but-1-ene;1-(3-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)isoquinoline (PubChem CID 144787298) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is but-1-ene;1-(3-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)isoquinoline.
| Compound Name | but-1-ene;1-(3-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)isoquinoline |
|---|---|
| PubChem CID | 144787298 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | but-1-ene;1-(3-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)isoquinoline |
| SMILES | C=CCC.CCC=CCC1CC=C(C)C=C1c1nccc2ccccc12 |
| InChI | InChI=1S/C21H23N.C4H8/c1-3-4-5-8-17-12-11-16(2)15-20(17)21-19-10-7-6-9-18(19)13-14-22-21;1-3-4-2/h4-7,9-11,13-15,17H,3,8,12H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | JODQSCQMSYJRGX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|