C22H33N — CID 142402961
2-(6-but-2-enyl-3-methylcyclohexa-1,3-dien-1-yl)pyridine;3-methylpentane (PubChem CID 142402961) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is 2-(6-but-2-enyl-3-methylcyclohexa-1,3-dien-1-yl)pyridine;3-methylpentane.
| Compound Name | 2-(6-but-2-enyl-3-methylcyclohexa-1,3-dien-1-yl)pyridine;3-methylpentane |
|---|---|
| PubChem CID | 142402961 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 2-(6-but-2-enyl-3-methylcyclohexa-1,3-dien-1-yl)pyridine;3-methylpentane |
| SMILES | CC=CCC1CC=C(C)C=C1c1ccccn1.CCC(C)CC |
| InChI | InChI=1S/C16H19N.C6H14/c1-3-4-7-14-10-9-13(2)12-15(14)16-8-5-6-11-17-16;1-4-6(3)5-2/h3-6,8-9,11-12,14H,7,10H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | OBKBGOQAWKSRGG-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|