C23H28 — CID 142304820
1-[1-(3-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)ethenyl]-2-[(Z)-prop-1-enyl]benzene (PubChem CID 142304820) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-[1-(3-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)ethenyl]-2-[(Z)-prop-1-enyl]benzene.
| Compound Name | 1-[1-(3-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)ethenyl]-2-[(Z)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 142304820 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[1-(3-methyl-6-pent-2-enylcyclohexa-1,3-dien-1-yl)ethenyl]-2-[(Z)-prop-1-enyl]benzene |
| SMILES | C=C(C1=CC(C)=CCC1CC=CCC)c1ccccc1/C=C\C |
| InChI | InChI=1S/C23H28/c1-5-7-8-12-21-16-15-18(3)17-23(21)19(4)22-14-10-9-13-20(22)11-6-2/h6-11,13-15,17,21H,4-5,12,16H2,1-3H3/b8-7?,11-6- |
| InChIKey | QTEXKEGOGLCJLA-FMQHEPIDSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|