C27H38 — CID 163298369
2-methylbutane;1-[1-(6-pent-2-enylcyclohexa-1,3-dien-1-yl)ethenyl]-2-[(Z)-prop-1-enyl]benzene (PubChem CID 163298369) has the molecular formula C27H38 and a molecular weight of 362.60 g/mol. Its IUPAC name is 2-methylbutane;1-[1-(6-pent-2-enylcyclohexa-1,3-dien-1-yl)ethenyl]-2-[(Z)-prop-1-enyl]benzene.
| Compound Name | 2-methylbutane;1-[1-(6-pent-2-enylcyclohexa-1,3-dien-1-yl)ethenyl]-2-[(Z)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 163298369 |
| Molecular Formula | C27H38 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 2-methylbutane;1-[1-(6-pent-2-enylcyclohexa-1,3-dien-1-yl)ethenyl]-2-[(Z)-prop-1-enyl]benzene |
| SMILES | C=C(C1=CC=CCC1CC=CCC)c1ccccc1/C=C\C.CCC(C)C |
| InChI | InChI=1S/C22H26.C5H12/c1-4-6-7-13-20-15-9-11-17-22(20)18(3)21-16-10-8-14-19(21)12-5-2;1-4-5(2)3/h5-12,14,16-17,20H,3-4,13,15H2,1-2H3;5H,4H2,1-3H3/b7-6?,12-5-; |
| InChIKey | HUGOIIPNQYMZLJ-SCFJZCNXSA-N |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|