C24H30 — CID 144615738
1-[(3Z)-5-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)penta-1,3-dien-2-yl]-2-methylbenzene (PubChem CID 144615738) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-[(3Z)-5-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)penta-1,3-dien-2-yl]-2-methylbenzene.
| Compound Name | 1-[(3Z)-5-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)penta-1,3-dien-2-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 144615738 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-[(3Z)-5-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)penta-1,3-dien-2-yl]-2-methylbenzene |
| SMILES | C=C(/C=C\CC1=CC=CCC1C(C)C=CCC)c1ccccc1C |
| InChI | InChI=1S/C24H30/c1-5-6-12-21(4)24-18-10-8-15-22(24)16-11-14-20(3)23-17-9-7-13-19(23)2/h6-15,17,21,24H,3,5,16,18H2,1-2,4H3/b12-6?,14-11- |
| InChIKey | CYJLEWHWVOCWGD-XOZGXGMZSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|