C21H16 — CID 145023526
4-[(1E)-3-(2-methylphenyl)buta-1,3-dienyl]tricyclo[4.4.0.02,10]deca-1,3,5,7,9-pentaene (PubChem CID 145023526) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[(1E)-3-(2-methylphenyl)buta-1,3-dienyl]tricyclo[4.4.0.02,10]deca-1,3,5,7,9-pentaene.
| Compound Name | 4-[(1E)-3-(2-methylphenyl)buta-1,3-dienyl]tricyclo[4.4.0.02,10]deca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 145023526 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-[(1E)-3-(2-methylphenyl)buta-1,3-dienyl]tricyclo[4.4.0.02,10]deca-1,3,5,7,9-pentaene |
| SMILES | C=C(/C=C/c1cc2c3c-2cccc3c1)c1ccccc1C |
| InChI | InChI=1S/C21H16/c1-14-6-3-4-8-18(14)15(2)10-11-16-12-17-7-5-9-19-20(13-16)21(17)19/h3-13H,2H2,1H3/b11-10+ |
| InChIKey | FPTLOEPIQJOOSU-ZHACJKMWSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|