C26H26ClN — CID 142104019
2-[(3E)-4-(3-chloro-4-methylphenyl)buta-1,3-dien-2-yl]-6-phenyl-N-propylaniline (PubChem CID 142104019) has the molecular formula C26H26ClN and a molecular weight of 387.95 g/mol. Its IUPAC name is 2-[(3E)-4-(3-chloro-4-methylphenyl)buta-1,3-dien-2-yl]-6-phenyl-N-propylaniline.
| Compound Name | 2-[(3E)-4-(3-chloro-4-methylphenyl)buta-1,3-dien-2-yl]-6-phenyl-N-propylaniline |
|---|---|
| PubChem CID | 142104019 |
| Molecular Formula | C26H26ClN |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[(3E)-4-(3-chloro-4-methylphenyl)buta-1,3-dien-2-yl]-6-phenyl-N-propylaniline |
| SMILES | C=C(/C=C/c1ccc(C)c(Cl)c1)c1cccc(-c2ccccc2)c1NCCC |
| InChI | InChI=1S/C26H26ClN/c1-4-17-28-26-23(11-8-12-24(26)22-9-6-5-7-10-22)19(2)13-15-21-16-14-20(3)25(27)18-21/h5-16,18,28H,2,4,17H2,1,3H3/b15-13+ |
| InChIKey | DDZCAMHRLUARHJ-FYWRMAATSA-N |
| XLogP | 7.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|