C21H20N4O3 — CID 144793006
1-[3-[(3R)-4-[ethyl(methyl)amino]-3-hydroxy-4-oxobut-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 144793006) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-[3-[(3R)-4-[ethyl(methyl)amino]-3-hydroxy-4-oxobut-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 1-[3-[(3R)-4-[ethyl(methyl)amino]-3-hydroxy-4-oxobut-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144793006 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-[3-[(3R)-4-[ethyl(methyl)amino]-3-hydroxy-4-oxobut-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | CCN(C)C(=O)[C@H](O)C#Cc1cccc(-c2nc(C(N)=O)n3ccccc23)c1 |
| InChI | InChI=1S/C21H20N4O3/c1-3-24(2)21(28)17(26)11-10-14-7-6-8-15(13-14)18-16-9-4-5-12-25(16)20(23-18)19(22)27/h4-9,12-13,17,26H,3H2,1-2H3,(H2,22,27)/t17-/m1/s1 |
| InChIKey | MAFPPHSHDDNKCE-QGZVFWFLSA-N |
| XLogP | 1.29 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|