C20H16ClN3O2 — CID 144793368
7-chloro-1-[3-[(3S)-3-hydroxy-3-methylpent-4-en-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 144793368) has the molecular formula C20H16ClN3O2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 7-chloro-1-[3-[(3S)-3-hydroxy-3-methylpent-4-en-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 7-chloro-1-[3-[(3S)-3-hydroxy-3-methylpent-4-en-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144793368 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 7-chloro-1-[3-[(3S)-3-hydroxy-3-methylpent-4-en-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | C=C[C@](C)(O)C#Cc1cccc(-c2nc(C(N)=O)n3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C20H16ClN3O2/c1-3-20(2,26)9-7-13-5-4-6-14(11-13)17-16-12-15(21)8-10-24(16)19(23-17)18(22)25/h3-6,8,10-12,26H,1H2,2H3,(H2,22,25)/t20-/m0/s1 |
| InChIKey | ZQZKSGYPKRJEMU-FQEVSTJZSA-N |
| XLogP | 3.04 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|