C22H24N2S — CID 144794424
2-methyl-4-[[2-(7-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-4-yl]methyl]aniline (PubChem CID 144794424) has the molecular formula C22H24N2S and a molecular weight of 348.52 g/mol. Its IUPAC name is 2-methyl-4-[[2-(7-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-4-yl]methyl]aniline.
| Compound Name | 2-methyl-4-[[2-(7-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 144794424 |
| Molecular Formula | C22H24N2S |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-methyl-4-[[2-(7-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-4-yl]methyl]aniline |
| SMILES | Cc1cc(Cc2csc(-c3ccc4c(c3)CC(C)CC4)n2)ccc1N |
| InChI | InChI=1S/C22H24N2S/c1-14-3-5-17-6-7-18(12-19(17)9-14)22-24-20(13-25-22)11-16-4-8-21(23)15(2)10-16/h4,6-8,10,12-14H,3,5,9,11,23H2,1-2H3 |
| InChIKey | VDITUACABUBCPQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|