C19H17N3S — CID 144794792
4-[4-[(4-amino-2,5-dimethylphenyl)methyl]-1,3-thiazol-2-yl]benzonitrile (PubChem CID 144794792) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-[4-[(4-amino-2,5-dimethylphenyl)methyl]-1,3-thiazol-2-yl]benzonitrile.
| Compound Name | 4-[4-[(4-amino-2,5-dimethylphenyl)methyl]-1,3-thiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 144794792 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-[4-[(4-amino-2,5-dimethylphenyl)methyl]-1,3-thiazol-2-yl]benzonitrile |
| SMILES | Cc1cc(Cc2csc(-c3ccc(C#N)cc3)n2)c(C)cc1N |
| InChI | InChI=1S/C19H17N3S/c1-12-8-18(21)13(2)7-16(12)9-17-11-23-19(22-17)15-5-3-14(10-20)4-6-15/h3-8,11H,9,21H2,1-2H3 |
| InChIKey | OVPMPOGIXQRZJQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|