C25H26F2N2O2S — CID 144795050
2-(7,7-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-1,3-thiazole (PubChem CID 144795050) has the molecular formula C25H26F2N2O2S and a molecular weight of 456.56 g/mol. Its IUPAC name is 2-(7,7-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-1,3-thiazole.
| Compound Name | 2-(7,7-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 144795050 |
| Molecular Formula | C25H26F2N2O2S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-(7,7-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-1,3-thiazole |
| SMILES | Cc1cc(Cc2csc(-c3ccc4c(c3)CCC(F)(F)CC4)n2)c(C)cc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C25H26F2N2O2S/c1-16-12-22(17(2)11-19(16)7-10-29(30)31)14-23-15-32-24(28-23)21-4-3-18-5-8-25(26,27)9-6-20(18)13-21/h3-4,11-13,15H,5-10,14H2,1-2H3 |
| InChIKey | ASYTWYOZWJKXHO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|