C23H24N2O4S — CID 144794446
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-1,3-thiazole (PubChem CID 144794446) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-1,3-thiazole.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 144794446 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-1,3-thiazole |
| SMILES | Cc1cc(Cc2csc(-c3ccc4c(c3)OCCCO4)n2)c(C)cc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N2O4S/c1-15-11-19(16(2)10-17(15)6-7-25(26)27)12-20-14-30-23(24-20)18-4-5-21-22(13-18)29-9-3-8-28-21/h4-5,10-11,13-14H,3,6-9,12H2,1-2H3 |
| InChIKey | CVZHJMKJFPTGAC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|