C27H29NO2S — CID 144794778
2-(1,2,2a,3,8,8a-hexahydrocyclobuta[b]naphthalen-5-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene (PubChem CID 144794778) has the molecular formula C27H29NO2S and a molecular weight of 431.60 g/mol. Its IUPAC name is 2-(1,2,2a,3,8,8a-hexahydrocyclobuta[b]naphthalen-5-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene.
| Compound Name | 2-(1,2,2a,3,8,8a-hexahydrocyclobuta[b]naphthalen-5-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene |
|---|---|
| PubChem CID | 144794778 |
| Molecular Formula | C27H29NO2S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-(1,2,2a,3,8,8a-hexahydrocyclobuta[b]naphthalen-5-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene |
| SMILES | Cc1cc(Cc2csc(-c3ccc4c(c3)CC3CCC3C4)c2)c(C)cc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C27H29NO2S/c1-17-10-25(18(2)9-20(17)7-8-28(29)30)11-19-12-27(31-16-19)24-6-5-23-13-21-3-4-22(21)14-26(23)15-24/h5-6,9-10,12,15-16,21-22H,3-4,7-8,11,13-14H2,1-2H3 |
| InChIKey | VHCRNMTWYXBLAN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|