C27H31NO2S — CID 163844626
2-(7,7-dimethyl-6,8-dihydro-5H-naphthalen-2-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene (PubChem CID 163844626) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is 2-(7,7-dimethyl-6,8-dihydro-5H-naphthalen-2-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene.
| Compound Name | 2-(7,7-dimethyl-6,8-dihydro-5H-naphthalen-2-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene |
|---|---|
| PubChem CID | 163844626 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-(7,7-dimethyl-6,8-dihydro-5H-naphthalen-2-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene |
| SMILES | Cc1cc(Cc2csc(-c3ccc4c(c3)CC(C)(C)CC4)c2)c(C)cc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C27H31NO2S/c1-18-12-24(19(2)11-22(18)8-10-28(29)30)13-20-14-26(31-17-20)23-6-5-21-7-9-27(3,4)16-25(21)15-23/h5-6,11-12,14-15,17H,7-10,13,16H2,1-4H3 |
| InChIKey | OPAVWYSOMPLCAM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|