C26H29NO2S2 — CID 144795041
5-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylbut-1-enyl]-1-benzothiophene (PubChem CID 144795041) has the molecular formula C26H29NO2S2 and a molecular weight of 451.66 g/mol. Its IUPAC name is 5-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylbut-1-enyl]-1-benzothiophene.
| Compound Name | 5-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylbut-1-enyl]-1-benzothiophene |
|---|---|
| PubChem CID | 144795041 |
| Molecular Formula | C26H29NO2S2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 5-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylbut-1-enyl]-1-benzothiophene |
| SMILES | CC/C=C(\S/C=C(\C)Cc1cc(C)c(CC[N+](=O)[O-])cc1C)c1ccc2sccc2c1 |
| InChI | InChI=1S/C26H29NO2S2/c1-5-6-25(22-7-8-26-23(16-22)10-12-30-26)31-17-18(2)13-24-15-19(3)21(14-20(24)4)9-11-27(28)29/h6-8,10,12,14-17H,5,9,11,13H2,1-4H3/b18-17+,25-6- |
| InChIKey | RMTABZHDWMDCIK-WSEAVTPOSA-N |
| XLogP | 7.97 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|