C25H27NO2S2 — CID 144794733
2-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylprop-1-enyl]-1-benzothiophene (PubChem CID 144794733) has the molecular formula C25H27NO2S2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 2-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylprop-1-enyl]-1-benzothiophene.
| Compound Name | 2-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylprop-1-enyl]-1-benzothiophene |
|---|---|
| PubChem CID | 144794733 |
| Molecular Formula | C25H27NO2S2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylprop-1-enyl]-1-benzothiophene |
| SMILES | C/C=C(\S/C=C(\C)Cc1cc(C)c(CC[N+](=O)[O-])cc1C)c1cc2ccccc2s1 |
| InChI | InChI=1S/C25H27NO2S2/c1-5-23(25-15-21-8-6-7-9-24(21)30-25)29-16-17(2)12-22-14-18(3)20(13-19(22)4)10-11-26(27)28/h5-9,13-16H,10-12H2,1-4H3/b17-16+,23-5- |
| InChIKey | GKGMCIJRGYBWTQ-HSTGVCDBSA-N |
| XLogP | 7.58 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|