C20H20N2O2 — CID 144798937
(1E,4E)-1-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]-4-[(Z)-prop-1-enyl]hepta-1,4,6-trien-3-one (PubChem CID 144798937) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (1E,4E)-1-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]-4-[(Z)-prop-1-enyl]hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E)-1-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]-4-[(Z)-prop-1-enyl]hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 144798937 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (1E,4E)-1-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]-4-[(Z)-prop-1-enyl]hepta-1,4,6-trien-3-one |
| SMILES | C=C/C=C(\C=C/C)C(=O)/C=C/c1cc(-c2ccc(OC)cc2)n[nH]1 |
| InChI | InChI=1S/C20H20N2O2/c1-4-6-16(7-5-2)20(23)13-10-17-14-19(22-21-17)15-8-11-18(24-3)12-9-15/h4-14H,1H2,2-3H3,(H,21,22)/b7-5-,13-10+,16-6+ |
| InChIKey | FQDOVWFZRQBSLZ-DYCVEZNOSA-N |
| XLogP | 4.36 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|