C25H32N2O2 — CID 144798999
2-[(Z)-[[2-[(1Z)-buta-1,3-dienyl]-3-methylphenyl]-(4-methoxyphenyl)methylidene]amino]oxy-N,N-diethylethanamine (PubChem CID 144798999) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-[(Z)-[[2-[(1Z)-buta-1,3-dienyl]-3-methylphenyl]-(4-methoxyphenyl)methylidene]amino]oxy-N,N-diethylethanamine.
| Compound Name | 2-[(Z)-[[2-[(1Z)-buta-1,3-dienyl]-3-methylphenyl]-(4-methoxyphenyl)methylidene]amino]oxy-N,N-diethylethanamine |
|---|---|
| PubChem CID | 144798999 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 2-[(Z)-[[2-[(1Z)-buta-1,3-dienyl]-3-methylphenyl]-(4-methoxyphenyl)methylidene]amino]oxy-N,N-diethylethanamine |
| SMILES | C=C/C=C\c1c(C)cccc1/C(=N\OCCN(CC)CC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H32N2O2/c1-6-9-12-23-20(4)11-10-13-24(23)25(21-14-16-22(28-5)17-15-21)26-29-19-18-27(7-2)8-3/h6,9-17H,1,7-8,18-19H2,2-5H3/b12-9-,26-25- |
| InChIKey | SSZJUHUGGVQRGI-YBCAGIJDSA-N |
| XLogP | 5.31 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|