C23H32N2O — CID 173416033
N,N-diethyl-2-[[1-(4-methylphenyl)-4-phenylbutylidene]amino]oxyethanamine (PubChem CID 173416033) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is N,N-diethyl-2-[[1-(4-methylphenyl)-4-phenylbutylidene]amino]oxyethanamine.
| Compound Name | N,N-diethyl-2-[[1-(4-methylphenyl)-4-phenylbutylidene]amino]oxyethanamine |
|---|---|
| PubChem CID | 173416033 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | N,N-diethyl-2-[[1-(4-methylphenyl)-4-phenylbutylidene]amino]oxyethanamine |
| SMILES | CCN(CC)CCON=C(CCCc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H32N2O/c1-4-25(5-2)18-19-26-24-23(22-16-14-20(3)15-17-22)13-9-12-21-10-7-6-8-11-21/h6-8,10-11,14-17H,4-5,9,12-13,18-19H2,1-3H3 |
| InChIKey | JQFXVGIOGAUQRO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|