C7H16N4 — CID 144800619
2-methyl-5-pentyl-1,3-dihydrotetrazole (PubChem CID 144800619) has the molecular formula C7H16N4 and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-methyl-5-pentyl-1,3-dihydrotetrazole.
| Compound Name | 2-methyl-5-pentyl-1,3-dihydrotetrazole |
|---|---|
| PubChem CID | 144800619 |
| Molecular Formula | C7H16N4 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 2-methyl-5-pentyl-1,3-dihydrotetrazole |
| SMILES | CCCCCC1=NNN(C)N1 |
| InChI | InChI=1S/C7H16N4/c1-3-4-5-6-7-8-10-11(2)9-7/h10H,3-6H2,1-2H3,(H,8,9) |
| InChIKey | COMJPGZSTPYDJQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|