C35H34Cl2N2O3S — CID 144800781
3-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-1-yl]-N-(4-phenylmethoxyphenyl)sulfanylpropanamide (PubChem CID 144800781) has the molecular formula C35H34Cl2N2O3S and a molecular weight of 633.64 g/mol. Its IUPAC name is 3-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-1-yl]-N-(4-phenylmethoxyphenyl)sulfanylpropanamide.
| Compound Name | 3-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-1-yl]-N-(4-phenylmethoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 144800781 |
| Molecular Formula | C35H34Cl2N2O3S |
| Molecular Weight | 633.64 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | 3-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-1-yl]-N-(4-phenylmethoxyphenyl)sulfanylpropanamide |
| SMILES | Cc1cc(OCCCc2cn(CCC(=O)NSc3ccc(OCc4ccccc4)cc3)c3cc(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C35H34Cl2N2O3S/c1-24-19-30(20-25(2)35(24)37)41-18-6-9-27-22-39(33-21-28(36)10-15-32(27)33)17-16-34(40)38-43-31-13-11-29(12-14-31)42-23-26-7-4-3-5-8-26/h3-5,7-8,10-15,19-22H,6,9,16-18,23H2,1-2H3,(H,38,40) |
| InChIKey | UEQBHSAJOXXGIA-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.64 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|