C24H29ClN2O2S — CID 144800786
2-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-1-yl]-N-methylsulfanylbutanamide (PubChem CID 144800786) has the molecular formula C24H29ClN2O2S and a molecular weight of 445.03 g/mol. Its IUPAC name is 2-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-1-yl]-N-methylsulfanylbutanamide.
| Compound Name | 2-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-1-yl]-N-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 144800786 |
| Molecular Formula | C24H29ClN2O2S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-1-yl]-N-methylsulfanylbutanamide |
| SMILES | CCC(C(=O)NSC)n1cc(CCCOc2cc(C)c(Cl)c(C)c2)c2ccccc21 |
| InChI | InChI=1S/C24H29ClN2O2S/c1-5-21(24(28)26-30-4)27-15-18(20-10-6-7-11-22(20)27)9-8-12-29-19-13-16(2)23(25)17(3)14-19/h6-7,10-11,13-15,21H,5,8-9,12H2,1-4H3,(H,26,28) |
| InChIKey | ZJZAILJYDHTQRY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|