C17H32N2O5 — CID 144806564
[2-hydroxy-3-(4-iminopentanoyloxy)propyl] 5-amino-4,4,5-trimethylhexanoate (PubChem CID 144806564) has the molecular formula C17H32N2O5 and a molecular weight of 344.45 g/mol. Its IUPAC name is [2-hydroxy-3-(4-iminopentanoyloxy)propyl] 5-amino-4,4,5-trimethylhexanoate.
| Compound Name | [2-hydroxy-3-(4-iminopentanoyloxy)propyl] 5-amino-4,4,5-trimethylhexanoate |
|---|---|
| PubChem CID | 144806564 |
| Molecular Formula | C17H32N2O5 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | [2-hydroxy-3-(4-iminopentanoyloxy)propyl] 5-amino-4,4,5-trimethylhexanoate |
| SMILES | [H]/N=C(\C)CCC(=O)OCC(O)COC(=O)CCC(C)(C)C(C)(C)N |
| InChI | InChI=1S/C17H32N2O5/c1-12(18)6-7-14(21)23-10-13(20)11-24-15(22)8-9-16(2,3)17(4,5)19/h13,18,20H,6-11,19H2,1-5H3/b18-12+ |
| InChIKey | NTHBAIDOZIQCIE-LDADJPATSA-N |
| XLogP | 1.80 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|