C20H38N2O5 — CID 144806586
2-[1-(4-iminopentanoyloxy)propan-2-yloxy]propyl 5-amino-4,4,5-trimethylhexanoate (PubChem CID 144806586) has the molecular formula C20H38N2O5 and a molecular weight of 386.53 g/mol. Its IUPAC name is 2-[1-(4-iminopentanoyloxy)propan-2-yloxy]propyl 5-amino-4,4,5-trimethylhexanoate.
| Compound Name | 2-[1-(4-iminopentanoyloxy)propan-2-yloxy]propyl 5-amino-4,4,5-trimethylhexanoate |
|---|---|
| PubChem CID | 144806586 |
| Molecular Formula | C20H38N2O5 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-[1-(4-iminopentanoyloxy)propan-2-yloxy]propyl 5-amino-4,4,5-trimethylhexanoate |
| SMILES | [H]/N=C(\C)CCC(=O)OCC(C)OC(C)COC(=O)CCC(C)(C)C(C)(C)N |
| InChI | InChI=1S/C20H38N2O5/c1-14(21)8-9-17(23)25-12-15(2)27-16(3)13-26-18(24)10-11-19(4,5)20(6,7)22/h15-16,21H,8-13,22H2,1-7H3/b21-14+ |
| InChIKey | FPSRFMKRGYRGRR-KGENOOAVSA-N |
| XLogP | 3.23 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|