C17H32N2O4 — CID 144806603
3-(4-iminopentanoyloxy)propyl 5-amino-4,4,5-trimethylhexanoate (PubChem CID 144806603) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is 3-(4-iminopentanoyloxy)propyl 5-amino-4,4,5-trimethylhexanoate.
| Compound Name | 3-(4-iminopentanoyloxy)propyl 5-amino-4,4,5-trimethylhexanoate |
|---|---|
| PubChem CID | 144806603 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 3-(4-iminopentanoyloxy)propyl 5-amino-4,4,5-trimethylhexanoate |
| SMILES | [H]/N=C(\C)CCC(=O)OCCCOC(=O)CCC(C)(C)C(C)(C)N |
| InChI | InChI=1S/C17H32N2O4/c1-13(18)7-8-14(20)22-11-6-12-23-15(21)9-10-16(2,3)17(4,5)19/h18H,6-12,19H2,1-5H3/b18-13+ |
| InChIKey | PHDZYPHWVLSSNQ-QGOAFFKASA-N |
| XLogP | 2.83 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|