C26H47N3O6 — CID 144806578
[2-(4-tert-butyliminopentanoyloxy)-3-(4-iminopentanoyloxy)propyl] 5-amino-4,4,5-trimethylhexanoate (PubChem CID 144806578) has the molecular formula C26H47N3O6 and a molecular weight of 497.68 g/mol. Its IUPAC name is [2-(4-tert-butyliminopentanoyloxy)-3-(4-iminopentanoyloxy)propyl] 5-amino-4,4,5-trimethylhexanoate.
| Compound Name | [2-(4-tert-butyliminopentanoyloxy)-3-(4-iminopentanoyloxy)propyl] 5-amino-4,4,5-trimethylhexanoate |
|---|---|
| PubChem CID | 144806578 |
| Molecular Formula | C26H47N3O6 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | [2-(4-tert-butyliminopentanoyloxy)-3-(4-iminopentanoyloxy)propyl] 5-amino-4,4,5-trimethylhexanoate |
| SMILES | [H]/N=C(\C)CCC(=O)OCC(COC(=O)CCC(C)(C)C(C)(C)N)OC(=O)CC/C(C)=N/C(C)(C)C |
| InChI | InChI=1S/C26H47N3O6/c1-18(27)10-12-21(30)33-16-20(35-23(32)13-11-19(2)29-24(3,4)5)17-34-22(31)14-15-25(6,7)26(8,9)28/h20,27H,10-17,28H2,1-9H3/b27-18+,29-19+ |
| InChIKey | OWMDRBRLXUFLRK-IMUYLQHBSA-N |
| XLogP | 4.39 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|