C18H21ClN4O4S — CID 14480729
[3-chloro-5-(diethylsulfamoyl)phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 14480729) has the molecular formula C18H21ClN4O4S and a molecular weight of 424.91 g/mol. Its IUPAC name is [3-chloro-5-(diethylsulfamoyl)phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [3-chloro-5-(diethylsulfamoyl)phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 14480729 |
| Molecular Formula | C18H21ClN4O4S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [3-chloro-5-(diethylsulfamoyl)phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(Cl)cc(OC(=O)c2ccc(N=C(N)N)cc2)c1 |
| InChI | InChI=1S/C18H21ClN4O4S/c1-3-23(4-2)28(25,26)16-10-13(19)9-15(11-16)27-17(24)12-5-7-14(8-6-12)22-18(20)21/h5-11H,3-4H2,1-2H3,(H4,20,21,22) |
| InChIKey | MQMOPYHKIGWZAX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|