C27H35N — CID 144808876
6-(5-buta-1,3-dien-2-yl-2-methylphenyl)-4,5-bis(ethenyl)-1,2-dihydropyridine;ethene;pent-2-ene (PubChem CID 144808876) has the molecular formula C27H35N and a molecular weight of 373.58 g/mol. Its IUPAC name is 6-(5-buta-1,3-dien-2-yl-2-methylphenyl)-4,5-bis(ethenyl)-1,2-dihydropyridine;ethene;pent-2-ene.
| Compound Name | 6-(5-buta-1,3-dien-2-yl-2-methylphenyl)-4,5-bis(ethenyl)-1,2-dihydropyridine;ethene;pent-2-ene |
|---|---|
| PubChem CID | 144808876 |
| Molecular Formula | C27H35N |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 6-(5-buta-1,3-dien-2-yl-2-methylphenyl)-4,5-bis(ethenyl)-1,2-dihydropyridine;ethene;pent-2-ene |
| SMILES | C=C.C=CC(=C)c1ccc(C)c(C2=C(C=C)C(C=C)=CCN2)c1.CC=CCC |
| InChI | InChI=1S/C20H21N.C5H10.C2H4/c1-6-14(4)17-10-9-15(5)19(13-17)20-18(8-3)16(7-2)11-12-21-20;1-3-5-4-2;1-2/h6-11,13,21H,1-4,12H2,5H3;3,5H,4H2,1-2H3;1-2H2 |
| InChIKey | FQLHWHDCNKEAKD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|