C18H24F4O — CID 144809530
(7Z)-3,3,4,4-tetrafluoro-5,6,9-trimethylidene-10-(2-methylpropoxy)undeca-1,7-diene (PubChem CID 144809530) has the molecular formula C18H24F4O and a molecular weight of 332.38 g/mol. Its IUPAC name is (7Z)-3,3,4,4-tetrafluoro-5,6,9-trimethylidene-10-(2-methylpropoxy)undeca-1,7-diene.
| Compound Name | (7Z)-3,3,4,4-tetrafluoro-5,6,9-trimethylidene-10-(2-methylpropoxy)undeca-1,7-diene |
|---|---|
| PubChem CID | 144809530 |
| Molecular Formula | C18H24F4O |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (7Z)-3,3,4,4-tetrafluoro-5,6,9-trimethylidene-10-(2-methylpropoxy)undeca-1,7-diene |
| SMILES | C=CC(F)(F)C(F)(F)C(=C)C(=C)/C=C\C(=C)C(C)OCC(C)C |
| InChI | InChI=1S/C18H24F4O/c1-8-17(19,20)18(21,22)15(6)13(4)9-10-14(5)16(7)23-11-12(2)3/h8-10,12,16H,1,4-6,11H2,2-3,7H3/b10-9- |
| InChIKey | VQVLMUIUAHTVBZ-KTKRTIGZSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|