C19H32F4O — CID 144809550
3,3,4,4-tetrafluoro-2,6,9,10-tetramethyl-5-methylidene-11-propan-2-yloxyundec-1-ene (PubChem CID 144809550) has the molecular formula C19H32F4O and a molecular weight of 352.46 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-2,6,9,10-tetramethyl-5-methylidene-11-propan-2-yloxyundec-1-ene.
| Compound Name | 3,3,4,4-tetrafluoro-2,6,9,10-tetramethyl-5-methylidene-11-propan-2-yloxyundec-1-ene |
|---|---|
| PubChem CID | 144809550 |
| Molecular Formula | C19H32F4O |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 3,3,4,4-tetrafluoro-2,6,9,10-tetramethyl-5-methylidene-11-propan-2-yloxyundec-1-ene |
| SMILES | C=C(C)C(F)(F)C(F)(F)C(=C)C(C)CCC(C)C(C)COC(C)C |
| InChI | InChI=1S/C19H32F4O/c1-12(2)18(20,21)19(22,23)17(8)15(6)10-9-14(5)16(7)11-24-13(3)4/h13-16H,1,8-11H2,2-7H3 |
| InChIKey | OBQNSGBWDXNCBT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|