C19H34F4O — CID 144809476
2,5-dimethylheptane;2-ethoxy-3,3,4,4-tetrafluoro-5-methylidenehept-1-ene (PubChem CID 144809476) has the molecular formula C19H34F4O and a molecular weight of 354.47 g/mol. Its IUPAC name is 2,5-dimethylheptane;2-ethoxy-3,3,4,4-tetrafluoro-5-methylidenehept-1-ene.
| Compound Name | 2,5-dimethylheptane;2-ethoxy-3,3,4,4-tetrafluoro-5-methylidenehept-1-ene |
|---|---|
| PubChem CID | 144809476 |
| Molecular Formula | C19H34F4O |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 2,5-dimethylheptane;2-ethoxy-3,3,4,4-tetrafluoro-5-methylidenehept-1-ene |
| SMILES | C=C(CC)C(F)(F)C(F)(F)C(=C)OCC.CCC(C)CCC(C)C |
| InChI | InChI=1S/C10H14F4O.C9H20/c1-5-7(3)9(11,12)10(13,14)8(4)15-6-2;1-5-9(4)7-6-8(2)3/h3-6H2,1-2H3;8-9H,5-7H2,1-4H3 |
| InChIKey | KCVVANIUZIUBIN-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|