C21H30F4O — CID 144809455
(7Z)-2-ethoxy-3,3,4,4-tetrafluoro-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,7-diene (PubChem CID 144809455) has the molecular formula C21H30F4O and a molecular weight of 374.46 g/mol. Its IUPAC name is (7Z)-2-ethoxy-3,3,4,4-tetrafluoro-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,7-diene.
| Compound Name | (7Z)-2-ethoxy-3,3,4,4-tetrafluoro-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,7-diene |
|---|---|
| PubChem CID | 144809455 |
| Molecular Formula | C21H30F4O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (7Z)-2-ethoxy-3,3,4,4-tetrafluoro-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,7-diene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)C(F)(F)C(F)(F)C(=C)OCC |
| InChI | InChI=1S/C21H30F4O/c1-9-26-19(8)21(24,25)20(22,23)18(7)17(6)13-12-16(5)15(4)11-10-14(2)3/h12-15H,5-11H2,1-4H3/b13-12- |
| InChIKey | RXZGUBJVOGUTMW-SEYXRHQNSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|