C25H44F4O — CID 144809571
1-(3,6-dimethylheptan-2-yloxy)-4,4,5,5-tetrafluoro-2,7,10-trimethyl-3,6-dimethylideneundecane (PubChem CID 144809571) has the molecular formula C25H44F4O and a molecular weight of 436.62 g/mol. Its IUPAC name is 1-(3,6-dimethylheptan-2-yloxy)-4,4,5,5-tetrafluoro-2,7,10-trimethyl-3,6-dimethylideneundecane.
| Compound Name | 1-(3,6-dimethylheptan-2-yloxy)-4,4,5,5-tetrafluoro-2,7,10-trimethyl-3,6-dimethylideneundecane |
|---|---|
| PubChem CID | 144809571 |
| Molecular Formula | C25H44F4O |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | 1-(3,6-dimethylheptan-2-yloxy)-4,4,5,5-tetrafluoro-2,7,10-trimethyl-3,6-dimethylideneundecane |
| SMILES | C=C(C(C)CCC(C)C)C(F)(F)C(F)(F)C(=C)C(C)COC(C)C(C)CCC(C)C |
| InChI | InChI=1S/C25H44F4O/c1-16(2)11-13-18(5)21(8)24(26,27)25(28,29)22(9)20(7)15-30-23(10)19(6)14-12-17(3)4/h16-20,23H,8-9,11-15H2,1-7,10H3 |
| InChIKey | DEUZPLADOSHUEA-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|