C16H26F4O — CID 144809464
ethene;3,3,4,4-tetrafluoro-2-methoxy-6,9-dimethyl-5-methylidenedec-1-ene (PubChem CID 144809464) has the molecular formula C16H26F4O and a molecular weight of 310.38 g/mol. Its IUPAC name is ethene;3,3,4,4-tetrafluoro-2-methoxy-6,9-dimethyl-5-methylidenedec-1-ene.
| Compound Name | ethene;3,3,4,4-tetrafluoro-2-methoxy-6,9-dimethyl-5-methylidenedec-1-ene |
|---|---|
| PubChem CID | 144809464 |
| Molecular Formula | C16H26F4O |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | ethene;3,3,4,4-tetrafluoro-2-methoxy-6,9-dimethyl-5-methylidenedec-1-ene |
| SMILES | C=C.C=C(OC)C(F)(F)C(F)(F)C(=C)C(C)CCC(C)C |
| InChI | InChI=1S/C14H22F4O.C2H4/c1-9(2)7-8-10(3)11(4)13(15,16)14(17,18)12(5)19-6;1-2/h9-10H,4-5,7-8H2,1-3,6H3;1-2H2 |
| InChIKey | SSWHIZQDUYVNOQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|