C22H38F4O — CID 144809474
1-(3,6-dimethyloctan-2-yloxy)-4,4,5,5-tetrafluoro-2-methyl-3,6-dimethylidenenonane (PubChem CID 144809474) has the molecular formula C22H38F4O and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-(3,6-dimethyloctan-2-yloxy)-4,4,5,5-tetrafluoro-2-methyl-3,6-dimethylidenenonane.
| Compound Name | 1-(3,6-dimethyloctan-2-yloxy)-4,4,5,5-tetrafluoro-2-methyl-3,6-dimethylidenenonane |
|---|---|
| PubChem CID | 144809474 |
| Molecular Formula | C22H38F4O |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 1-(3,6-dimethyloctan-2-yloxy)-4,4,5,5-tetrafluoro-2-methyl-3,6-dimethylidenenonane |
| SMILES | C=C(CCC)C(F)(F)C(F)(F)C(=C)C(C)COC(C)C(C)CCC(C)CC |
| InChI | InChI=1S/C22H38F4O/c1-9-11-18(6)21(23,24)22(25,26)19(7)17(5)14-27-20(8)16(4)13-12-15(3)10-2/h15-17,20H,6-7,9-14H2,1-5,8H3 |
| InChIKey | QCVYVRANWGDLGW-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|