C14H22F4O — CID 144809465
3,3,4,4-tetrafluoro-2-methoxy-6,9-dimethyl-5-methylidenedec-1-ene (PubChem CID 144809465) has the molecular formula C14H22F4O and a molecular weight of 282.32 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-2-methoxy-6,9-dimethyl-5-methylidenedec-1-ene.
| Compound Name | 3,3,4,4-tetrafluoro-2-methoxy-6,9-dimethyl-5-methylidenedec-1-ene |
|---|---|
| PubChem CID | 144809465 |
| Molecular Formula | C14H22F4O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3,3,4,4-tetrafluoro-2-methoxy-6,9-dimethyl-5-methylidenedec-1-ene |
| SMILES | C=C(OC)C(F)(F)C(F)(F)C(=C)C(C)CCC(C)C |
| InChI | InChI=1S/C14H22F4O/c1-9(2)7-8-10(3)11(4)13(15,16)14(17,18)12(5)19-6/h9-10H,4-5,7-8H2,1-3,6H3 |
| InChIKey | JGQQGWAYLSFFON-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|